CAS 1358749-55-9 appears in our catalog under these names: TAK-137/ 99.27% (existing batch purity), TAK-137. Offered by: TargetMol, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg.
9-(4-phenoxyphenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide (CAS 1358749-55-9) is a chemical compound with the molecular formula C19H16N2O3S and a molecular weight of 352.4 g/mol. IUPAC name: 9-(4-phenoxyphenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide. InChIKey: VKKLOYOLCCDGLD-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O3S |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 9-(4-phenoxyphenyl)-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine 2,2-dioxide |
| InChIKey | VKKLOYOLCCDGLD-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)N=C2N1C=CC=C2C3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)