CAS 52535-76-9 appears in our catalog under these names: TBT1/ 99.27% (existing batch purity), TBT1, Msba inhibitor 1, 2-[(4-Chlorobenzoyl)amino]-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylic acid, 95%+, 95%+, TBT1, 99.29%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
2-[(4-chlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CAS 52535-76-9) is a chemical compound with the molecular formula C16H14ClNO3S and a molecular weight of 335.8 g/mol. IUPAC name: 2-[(4-chlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid. InChIKey: DUJFDTGMUKWELI-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNO3S |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 2-[(4-chlorobenzoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid |
| InChIKey | DUJFDTGMUKWELI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)