cas: 1192688-51-9 — see every product listed under this CAS number, including other names
TERT-BUTYL 1-(HYDROXYMETHYL)-3-AZABICYCLO[4.1.0]HEPTANE-3-CARBOXYLATE, 97% (CAS 1192688-51-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531368-50MG |
| cas | 1192688-51-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 529.00 Pln | |
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1278.73 Pln | |
| Fluorochem | 1g | 3017.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate (CAS 1192688-51-9) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate. InChIKey: GMAGWSPHCFZKPN-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| InChIKey | GMAGWSPHCFZKPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2CC2(C1)CO |
Computed by PubChem (NCBI)