cas: 1192688-51-9 — see every product listed under this CAS number, including other names
tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate, 97%, 97% (CAS 1192688-51-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FM0F-1g |
| cas | 1192688-51-9 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2498.00 Pln | |
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 995.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate (CAS 1192688-51-9) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate. InChIKey: GMAGWSPHCFZKPN-UHFFFAOYSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl 1-(hydroxymethyl)-3-azabicyclo[4.1.0]heptane-3-carboxylate |
| InChIKey | GMAGWSPHCFZKPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2CC2(C1)CO |
Computed by PubChem (NCBI)