cas: 569667-93-2 — see every product listed under this CAS number, including other names
TERT-BUTYL 3-(METHOXY(METHYL)CARBAMOYL)PYRROLIDINE-1-CARBOXYLATE, 97% (CAS 569667-93-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332413-1G |
| cas | 569667-93-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2059.71 Pln | |
| Fluorochem | 5g | 6016.65 Pln | |
| Fluorochem | 500mg | 1403.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate (CAS 569667-93-2) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: tert-butyl 3-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate. InChIKey: LAAAMOQBIKIHLV-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | tert-butyl 3-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
| InChIKey | LAAAMOQBIKIHLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(=O)N(C)OC |
Computed by PubChem (NCBI)