cas: 220913-43-9 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-AMINO-2-FLUOROPHENYLCARBAMATE, 95% (CAS 220913-43-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334053-50MG |
| cas | 220913-43-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 372.80 Pln | |
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 794.53 Pln | |
| Fluorochem | 500mg | 1450.55 Pln | |
| Fluorochem | 1g | 2153.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-amino-2-fluorophenyl)carbamate (CAS 220913-43-9) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(4-amino-2-fluorophenyl)carbamate. InChIKey: WBYYPBQKOOBWAE-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(4-amino-2-fluorophenyl)carbamate |
| InChIKey | WBYYPBQKOOBWAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)