cas: 871013-92-2 — see every product listed under this CAS number, including other names
TERT-BUTYL 4-HYDROXY-2,3-DIHYDRO-1H-ISOINDOLE-2-CARBOXYLATE, 98% (CAS 871013-92-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513511-100MG |
| cas | 871013-92-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 534.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate (CAS 871013-92-2) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate. InChIKey: KAWGDHUTSZFFIP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-1,3-dihydroisoindole-2-carboxylate |
| InChIKey | KAWGDHUTSZFFIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)C(=CC=C2)O |
Computed by PubChem (NCBI)