cas: 740806-51-3 — see every product listed under this CAS number, including other names
TERT-BUTYL N-(5-BROMO-2-CHLOROPHENYL)CARBAMATE, 96%, 96% (CAS 740806-51-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11MC15-100mg |
| cas | 740806-51-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1816.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-2-chlorophenyl)carbamate (CAS 740806-51-3) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-chlorophenyl)carbamate. InChIKey: QPLKXDQLRIQYIA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-chlorophenyl)carbamate |
| InChIKey | QPLKXDQLRIQYIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)