cas: 740806-51-3 — see every product listed under this CAS number, including other names
Tert-butyl (5-bromo-2-chlorophenyl)carbamate, 96% (CAS 740806-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695787-250MG |
| cas | 740806-51-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 685.19 Pln | |
| Fluorochem | 2.5g | 1320.39 Pln | |
| Fluorochem | 5g | 1945.17 Pln | |
| Fluorochem | 10g | 3663.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(5-bromo-2-chlorophenyl)carbamate (CAS 740806-51-3) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-chlorophenyl)carbamate. InChIKey: QPLKXDQLRIQYIA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-chlorophenyl)carbamate |
| InChIKey | QPLKXDQLRIQYIA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)