cas: 1197300-24-5 — see every product listed under this CAS number, including other names
TGR5 Receptor Agonist 98% (CAS 1197300-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A672110-1mg |
| cas | 1197300-24-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 142.31 Pln | |
| Ambeed | 5mg | 203.50 Pln | |
| Ambeed | 10mg | 259.12 Pln | |
| Ambeed | 25mg | 381.50 Pln | |
| Ambeed | 50mg | 592.88 Pln | |
| Ambeed | 100mg | 943.31 Pln | |
| Ambeed | 250mg | 1555.19 Pln | |
| Ambeed | 1g | 4080.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A672110 |
3-(2-chlorophenyl)-N-(4-chlorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide (CAS 1197300-24-5) is a chemical compound with the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.2 g/mol. IUPAC name: 3-(2-chlorophenyl)-N-(4-chlorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide. InChIKey: IGRCWJPBLWGNPX-UHFFFAOYSA-N.
| Molecular formula | C18H14Cl2N2O2 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-N-(4-chlorophenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide |
| InChIKey | IGRCWJPBLWGNPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N(C)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)