CAS 1679333-73-3 appears in our catalog under these names: MMV008138, 98%, MMV008138, MMV008138, 98.49%, MMV008138, 99.48%. Offered by: AmBeed, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 25mg, 10mg, 50mg, 100 mg, 10mM/1mL, 10 mg, 5 mg.
(1R,3S)-1-(2,4-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 1679333-73-3) is a chemical compound with the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.2 g/mol. IUPAC name: (1R,3S)-1-(2,4-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: ZJDRIKAAFJMYGX-JKSUJKDBSA-N.
| Molecular formula | C18H14Cl2N2O2 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | (1R,3S)-1-(2,4-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | ZJDRIKAAFJMYGX-JKSUJKDBSA-N |
| SMILES | C1[C@H](N[C@@H](C2=C1C3=CC=CC=C3N2)C4=C(C=C(C=C4)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)