CAS 153948-24-4 is the registry number for (3-(2,6-dichlorophenyl)-5-methylisoxazol-4-yl)-N-benzylformamide. Offered by: Biosynth. Available pack sizes: 1g.
N-benzyl-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (CAS 153948-24-4) is a chemical compound with the molecular formula C18H14Cl2N2O2 and a molecular weight of 361.2 g/mol. IUPAC name: N-benzyl-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide. InChIKey: GZSORCIVOKSKOP-UHFFFAOYSA-N.
| Molecular formula | C18H14Cl2N2O2 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | N-benzyl-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| InChIKey | GZSORCIVOKSKOP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC=C2Cl)Cl)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)