cas: 1347750-77-9 — see every product listed under this CAS number, including other names
THIOL-PEG7-ACID, 97% (CAS 1347750-77-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533560-25MG |
| cas | 1347750-77-9 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 862.21 Pln | |
| Fluorochem | 50mg | 1414.10 Pln | |
| Fluorochem | 100mg | 2361.69 Pln | |
| Fluorochem | 250mg | 3954.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-77-9) is a chemical compound with the molecular formula C15H30O8S and a molecular weight of 370.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RSFZNXGXOCUHLT-UHFFFAOYSA-N.
| Molecular formula | C15H30O8S |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RSFZNXGXOCUHLT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCS)C(=O)O |
Computed by PubChem (NCBI)