cas: 1347750-77-9 — see every product listed under this CAS number, including other names
Thiol-PEG6-acid, 97%, 97% (CAS 1347750-77-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11A28U-50mg |
| cas | 1347750-77-9 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 909.20 Pln | |
| Chemat | 1g | 2718.80 Pln | |
| Chemat | 25mg | 227.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-77-9) is a chemical compound with the molecular formula C15H30O8S and a molecular weight of 370.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RSFZNXGXOCUHLT-UHFFFAOYSA-N.
| Molecular formula | C15H30O8S |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RSFZNXGXOCUHLT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCS)C(=O)O |
Computed by PubChem (NCBI)