cas: 1347750-77-9 — see every product listed under this CAS number, including other names
Thiol-PEG6-acid 97% (CAS 1347750-77-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A492299-50mg |
| cas | 1347750-77-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 470.50 Pln | |
| Ambeed | 100mg | 787.56 Pln | |
| Ambeed | 250mg | 1193.62 Pln | |
| Ambeed | 1g | 3435.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A492299 |
3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-77-9) is a chemical compound with the molecular formula C15H30O8S and a molecular weight of 370.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RSFZNXGXOCUHLT-UHFFFAOYSA-N.
| Molecular formula | C15H30O8S |
|---|---|
| Molecular weight | 370.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RSFZNXGXOCUHLT-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCS)C(=O)O |
Computed by PubChem (NCBI)