CAS 1903783-48-1 appears in our catalog under these names: TK216, TK216/ 98.45% (existing batch purity), TK216 99%, 4,7-Dichloro-3-(2-(4-cyclopropylphenyl)-2-oxoethyl)-3-hydroxyindolin-2-one, 99%, 99%, TK216, 99.65%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
4,7-dichloro-3-[2-(4-cyclopropylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one (CAS 1903783-48-1) is a chemical compound with the molecular formula C19H15Cl2NO3 and a molecular weight of 376.2 g/mol. IUPAC name: 4,7-dichloro-3-[2-(4-cyclopropylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one. InChIKey: ZWHNLSHDLKIXOG-UHFFFAOYSA-N.
| Molecular formula | C19H15Cl2NO3 |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | 4,7-dichloro-3-[2-(4-cyclopropylphenyl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| InChIKey | ZWHNLSHDLKIXOG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C=C2)C(=O)CC3(C4=C(C=CC(=C4NC3=O)Cl)Cl)O |
Computed by PubChem (NCBI)