cas: 65181-78-4 — see every product listed under this CAS number, including other names
TPD 97% (CAS 65181-78-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153094-1g |
| cas | 65181-78-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 932.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A153094 |
3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline (CAS 65181-78-4) is a chemical compound with the molecular formula C38H32N2 and a molecular weight of 516.7 g/mol. IUPAC name: 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline. InChIKey: OGGKVJMNFFSDEV-UHFFFAOYSA-N.
| Molecular formula | C38H32N2 |
|---|---|
| Molecular weight | 516.7 g/mol |
| IUPAC name | 3-methyl-N-[4-[4-(N-(3-methylphenyl)anilino)phenyl]phenyl]-N-phenylaniline |
| InChIKey | OGGKVJMNFFSDEV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)N(C5=CC=CC=C5)C6=CC=CC(=C6)C |
Computed by PubChem (NCBI)