cas: 1271810-25-3 — see every product listed under this CAS number, including other names
TRANS--1-(TERT-BUTOXYCARBONYL)-4-METHYLPIPERIDINE-3-CARBOXYLIC ACID, 97% (CAS 1271810-25-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F388052-100MG |
| cas | 1271810-25-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1153.78 Pln | |
| Fluorochem | 250mg | 2226.32 Pln | |
| Fluorochem | 500mg | 3673.72 Pln | |
| Fluorochem | 1g | 6073.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 1271810-25-3) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: IFPZGYNNPYYDGA-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R,4S)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | IFPZGYNNPYYDGA-IUCAKERBSA-N |
| SMILES | C[C@H]1CCN(C[C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)