CAS 246020-68-8 appears in our catalog under these names: TRi-1/ 98.4% (existing batch purity), TRi–1, TRi-1 98%, 2-((4-Chlorophenyl)sulfonyl)-6-methoxy-3-nitropyridine, 98%, 98%, TRi-1, 99.91%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
2-(4-chlorophenyl)sulfonyl-6-methoxy-3-nitropyridine (CAS 246020-68-8) is a chemical compound with the molecular formula C12H9ClN2O5S and a molecular weight of 328.73 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfonyl-6-methoxy-3-nitropyridine. InChIKey: PRKWNRUVAZZHPH-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O5S |
|---|---|
| Molecular weight | 328.73 g/mol |
| IUPAC name | 2-(4-chlorophenyl)sulfonyl-6-methoxy-3-nitropyridine |
| InChIKey | PRKWNRUVAZZHPH-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[N+](=O)[O-])S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)