CAS 1164471-33-3 appears in our catalog under these names: TT-012/ 99.91% (existing batch purity), TT–012, (2E,2'E)-N,N'-(Pyridine-2,6-diyl)bis(3-(furan-2-yl)acrylamide), 98%, 98%, TT-012, 99.76%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
(E)-3-(furan-2-yl)-N-[6-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-pyridinyl]prop-2-enamide (CAS 1164471-33-3) is a chemical compound with the molecular formula C19H15N3O4 and a molecular weight of 349.3 g/mol. IUPAC name: (E)-3-(furan-2-yl)-N-[6-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-pyridinyl]prop-2-enamide. InChIKey: YUFJMFXVUUMVCA-GFULKKFKSA-N.
| Molecular formula | C19H15N3O4 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | (E)-3-(furan-2-yl)-N-[6-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-2-pyridinyl]prop-2-enamide |
| InChIKey | YUFJMFXVUUMVCA-GFULKKFKSA-N |
| SMILES | C1=CC(=NC(=C1)NC(=O)/C=C/C2=CC=CO2)NC(=O)/C=C/C3=CC=CO3 |
Computed by PubChem (NCBI)