Products 178600-17-4
CAS 178600-17-4 appears in our catalog under these names: Talibegron hydrochloride/ 99.82% (existing batch purity), ZD 2079, Talibegron hydrochloride, Talibegron (hydrochloride), Talibegron (hydrochloride), 99.63%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid;hydrochloride (CAS 178600-17-4) is a chemical compound with the molecular formula C18H22ClNO4 and a molecular weight of 351.8 g/mol. IUPAC name: 2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid;hydrochloride. InChIKey: KCEFVYIWOQSJCH-LMOVPXPDSA-N.
| Molecular formula | C18H22ClNO4 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | 2-[4-[2-[[(2R)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]acetic acid;hydrochloride |
| InChIKey | KCEFVYIWOQSJCH-LMOVPXPDSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CNCCOC2=CC=C(C=C2)CC(=O)O)O.Cl |
Computed by PubChem (NCBI)