cas: 113942-30-6 — see every product listed under this CAS number, including other names
Temozolomide acid 98% (CAS 113942-30-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147506-100mg |
| cas | 113942-30-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1583.00 Pln | |
| Ambeed | 10g | 2473.00 Pln | |
| Ambeed | 25g | 4876.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A147506 |
3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid (CAS 113942-30-6) is a chemical compound with the molecular formula C6H5N5O3 and a molecular weight of 195.14 g/mol. IUPAC name: 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid. InChIKey: VVTMIOYTNALQAW-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O3 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid |
| InChIKey | VVTMIOYTNALQAW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)C(=O)O |
Computed by PubChem (NCBI)