CAS 113942-30-6 appears in our catalog under these names: Temozolomide EP Impurity B (Temozolomide Acid), Temozolomide EP Impurity B, Temozolomide Acid/ 99.28% (existing batch purity), Temozolomide Acid, Temozolomide acid. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: on request, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg, 1000mg.
3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid (CAS 113942-30-6) is a chemical compound with the molecular formula C6H5N5O3 and a molecular weight of 195.14 g/mol. IUPAC name: 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid. InChIKey: VVTMIOYTNALQAW-UHFFFAOYSA-N.
| Molecular formula | C6H5N5O3 |
|---|---|
| Molecular weight | 195.14 g/mol |
| IUPAC name | 3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid |
| InChIKey | VVTMIOYTNALQAW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N2C=NC(=C2N=N1)C(=O)O |
Computed by PubChem (NCBI)