CAS 1639417-53-0 appears in our catalog under these names: Tenalisib/ 99.71% (existing batch purity), Tenalisib (RP6530), Tenalisib (RP6530), Tenalisib 98%, Tenalisib, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one (CAS 1639417-53-0) is a chemical compound with the molecular formula C23H18FN5O2 and a molecular weight of 415.4 g/mol. IUPAC name: 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one. InChIKey: HDXDQPRPFRKGKZ-INIZCTEOSA-N.
| Molecular formula | C23H18FN5O2 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | 3-(3-fluorophenyl)-2-[(1S)-1-(7H-purin-6-ylamino)propyl]chromen-4-one |
| InChIKey | HDXDQPRPFRKGKZ-INIZCTEOSA-N |
| SMILES | CC[C@@H](C1=C(C(=O)C2=CC=CC=C2O1)C3=CC(=CC=C3)F)NC4=NC=NC5=C4NC=N5 |
Computed by PubChem (NCBI)