cas: 954236-44-3 — see every product listed under this CAS number, including other names
Tert-Butyl 3-Oxo-1-Oxa-8-Azaspiro[4.5]Decane-8-Carboxylate, 97%, 97% (CAS 954236-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144RV-100mg |
| cas | 954236-44-3 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 10g | 818.00 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4624.40 Pln | |
| Chemat | 250g | 4763.60 Pln | |
| Chemat | 500g | 9355.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 954236-44-3) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: XDSCHYPLQWGQRC-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | tert-butyl 3-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | XDSCHYPLQWGQRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)CO2 |
Computed by PubChem (NCBI)