cas: 748805-96-1 — see every product listed under this CAS number, including other names
Tert-Butyl 6-methylene-1,4-oxazepane-4-carboxylate, 98%, 98% (CAS 748805-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GHM7-100mg |
| cas | 748805-96-1 |
| size | 100mg |
| availability | 24g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1154.00 Pln | |
| Chemat | 10g | 1898.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate (CAS 748805-96-1) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate. InChIKey: UHNJPHHZWSDWHT-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 6-methylidene-1,4-oxazepane-4-carboxylate |
| InChIKey | UHNJPHHZWSDWHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC(=C)C1 |
Computed by PubChem (NCBI)