cas: 375853-79-5 — see every product listed under this CAS number, including other names
Tert-butyl (5-iodopyridin-2-yl)carbamate, 97%, 97% (CAS 375853-79-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UIX-50mg |
| cas | 375853-79-5 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 160.40 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-iodo-2-pyridinyl)carbamate (CAS 375853-79-5) is a chemical compound with the molecular formula C10H13IN2O2 and a molecular weight of 320.13 g/mol. IUPAC name: tert-butyl N-(5-iodo-2-pyridinyl)carbamate. InChIKey: YZLXIVKPYUFJPN-UHFFFAOYSA-N.
| Molecular formula | C10H13IN2O2 |
|---|---|
| Molecular weight | 320.13 g/mol |
| IUPAC name | tert-butyl N-(5-iodo-2-pyridinyl)carbamate |
| InChIKey | YZLXIVKPYUFJPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)I |
Computed by PubChem (NCBI)