cas: 124619-74-5 — see every product listed under this CAS number, including other names
Tert-butyl 2-amino-2-phenylacetate, 97% (CAS 124619-74-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F555309-250MG |
| cas | 124619-74-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1747.32 Pln | |
| Fluorochem | 10g | 3423.81 Pln | |
| Fluorochem | 25g | 6792.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-amino-2-phenylacetate (CAS 124619-74-5) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 2-amino-2-phenylacetate. InChIKey: HJLYKRGXTOVWFL-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 2-amino-2-phenylacetate |
| InChIKey | HJLYKRGXTOVWFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)