CAS 2820191-51-1 is the registry number for tert-Butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azepane-1-carboxylate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azepane-1-carboxylate (CAS 2820191-51-1) is a chemical compound with the molecular formula C17H32BNO4 and a molecular weight of 325.3 g/mol. IUPAC name: tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azepane-1-carboxylate. InChIKey: WUFUQJHXYZAEER-UHFFFAOYSA-N.
| Molecular formula | C17H32BNO4 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azepane-1-carboxylate |
| InChIKey | WUFUQJHXYZAEER-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)