cas: 144298-04-4 — see every product listed under this CAS number, including other names
Tert-butyl n-(3,4-difluorophenyl)carbamate, 98% (CAS 144298-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F659063-100MG |
| cas | 144298-04-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 2101.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(3,4-difluorophenyl)carbamate (CAS 144298-04-4) is a chemical compound with the molecular formula C11H13F2NO2 and a molecular weight of 229.22 g/mol. IUPAC name: tert-butyl N-(3,4-difluorophenyl)carbamate. InChIKey: WIUZQRIAAKGULG-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO2 |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | tert-butyl N-(3,4-difluorophenyl)carbamate |
| InChIKey | WIUZQRIAAKGULG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)