Products 1892501-79-9
CAS 1892501-79-9 is the registry number for (2,2-Difluoro-benzo[1,3]dioxol-5-ylmethyl)-isopropyl-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]propan-2-amine (CAS 1892501-79-9) is a chemical compound with the molecular formula C11H13F2NO2 and a molecular weight of 229.22 g/mol. IUPAC name: N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]propan-2-amine. InChIKey: WQHHTUBMPVSYOL-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO2 |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]propan-2-amine |
| InChIKey | WQHHTUBMPVSYOL-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)