CAS 129589-71-5 appears in our catalog under these names: (2,5-Difluoro-phenyl)-carbamic acid tert-butyl ester, 95%, tert-Butyl (2,5-difluorophenyl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl N-(2,5-difluorophenyl)carbamate (CAS 129589-71-5) is a chemical compound with the molecular formula C11H13F2NO2 and a molecular weight of 229.22 g/mol. IUPAC name: tert-butyl N-(2,5-difluorophenyl)carbamate. InChIKey: GYGIJXBUYRDFKK-UHFFFAOYSA-N.
| Molecular formula | C11H13F2NO2 |
|---|---|
| Molecular weight | 229.22 g/mol |
| IUPAC name | tert-butyl N-(2,5-difluorophenyl)carbamate |
| InChIKey | GYGIJXBUYRDFKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)