CAS 251565-85-2 appears in our catalog under these names: Tesaglitazar, 98%, Tesaglitazar, Tesaglitazar/ 99.89% (existing batch purity), Tesaglitazar, ≥95%(HPLC), ≥95%(HPLC), Tesaglitazar, 99.08%. Offered by: AmBeed, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10mg, 1mg, 5mg, 25mg, 50mg.
(2S)-2-ethoxy-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]propanoic acid (CAS 251565-85-2) is a chemical compound with the molecular formula C20H24O7S and a molecular weight of 408.5 g/mol. IUPAC name: (2S)-2-ethoxy-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]propanoic acid. InChIKey: CXGTZJYQWSUFET-IBGZPJMESA-N.
| Molecular formula | C20H24O7S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (2S)-2-ethoxy-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]propanoic acid |
| InChIKey | CXGTZJYQWSUFET-IBGZPJMESA-N |
| SMILES | CCO[C@@H](CC1=CC=C(C=C1)OCCC2=CC=C(C=C2)OS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)