cas: 1131912-76-9 — see every product listed under this CAS number, including other names
Tetrahydro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-pyran, 97%, 97% (CAS 1131912-76-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114992-100mg |
| cas | 1131912-76-9 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 3165.20 Pln | |
| Chemat | 50g | 5229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(oxan-4-yl)-1,3,2-dioxaborolane (CAS 1131912-76-9) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxan-4-yl)-1,3,2-dioxaborolane. InChIKey: NLSMOSUUBUCSPL-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxan-4-yl)-1,3,2-dioxaborolane |
| InChIKey | NLSMOSUUBUCSPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCOCC2 |
Computed by PubChem (NCBI)