CAS 1361022-66-3 is the registry number for 5-(Tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-one (CAS 1361022-66-3) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-one. InChIKey: BJRUSPJQCHTIHK-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pentan-2-one |
| InChIKey | BJRUSPJQCHTIHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC(=O)C |
Computed by PubChem (NCBI)