CAS 1391850-39-7 appears in our catalog under these names: Tetrahydropyran-3-boronic acid pinacol ester, 98%, Tetrahydropyran-3-boronic acid pinacol ester, 4,4,5,5-Tetramethyl-2-(tetrahydro-2H-pyran-3-yl)-1,3,2-dioxaborolane 97%, 4,4,5,5-Tetramethyl-2-(tetrahydro-2H-pyran-3-yl)-1,3,2-dioxaborolane, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 2000mg, 100mg.
4,4,5,5-tetramethyl-2-(oxan-3-yl)-1,3,2-dioxaborolane (CAS 1391850-39-7) is a chemical compound with the molecular formula C11H21BO3 and a molecular weight of 212.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxan-3-yl)-1,3,2-dioxaborolane. InChIKey: XSXAADPZJBSVSG-UHFFFAOYSA-N.
| Molecular formula | C11H21BO3 |
|---|---|
| Molecular weight | 212.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxan-3-yl)-1,3,2-dioxaborolane |
| InChIKey | XSXAADPZJBSVSG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCCOC2 |
Computed by PubChem (NCBI)