CAS 1009816-48-1 appears in our catalog under these names: Thiamet G/ 99.76% (existing batch purity), Thiamet G, Thiamet G - Bio-X â„¢, Thiamet G, O-GlcNAcase Inhibitor, TMG 1PC X 25MG. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
(3aR,5R,6S,7R,7aR)-2-ethylimino-5-(hydroxymethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (CAS 1009816-48-1) is a chemical compound with the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. IUPAC name: (3aR,5R,6S,7R,7aR)-2-ethylimino-5-(hydroxymethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol. InChIKey: PPAIMZHKIXDJRN-FMDGEEDCSA-N.
| Molecular formula | C9H16N2O4S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | (3aR,5R,6S,7R,7aR)-2-ethylimino-5-(hydroxymethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| InChIKey | PPAIMZHKIXDJRN-FMDGEEDCSA-N |
| SMILES | CCN=C1N[C@@H]2[C@H]([C@@H]([C@H](O[C@@H]2S1)CO)O)O |
Computed by PubChem (NCBI)