cas: 39541-91-8 — see every product listed under this CAS number, including other names
Thiazole, 2-methyl-4-(3-nitrophenyl)-, 98%, 98% (CAS 39541-91-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8S4-250mg |
| cas | 39541-91-8 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 3414.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-4-(3-nitrophenyl)-1,3-thiazole (CAS 39541-91-8) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 2-methyl-4-(3-nitrophenyl)-1,3-thiazole. InChIKey: VWKXLZKNKFOCCW-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 2-methyl-4-(3-nitrophenyl)-1,3-thiazole |
| InChIKey | VWKXLZKNKFOCCW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)