Thiazole-2,4-dicarboxylic acid, 95%
cas: 89379-29-3 — see every product listed under this CAS number, including other names
Thiazole-2,4-dicarboxylic acid, 95% (CAS 89379-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2631188-100mg |
| cas | 89379-29-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1188.06 Pln | |
| Ambeed | 1g | 3045.94 Pln | |
| Chemat | 100mg | 568.40 Pln | |
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 2382.80 Pln | |
| BLDpharm | 100mg | 686.45 Pln | |
| BLDpharm | 250mg | 1164.06 Pln | |
| BLDpharm | 1g | 2980.09 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,3-thiazole-2,4-dicarboxylic acid (CAS 89379-29-3) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-2,4-dicarboxylic acid. InChIKey: RUTJJFYMKNSTIA-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 1,3-thiazole-2,4-dicarboxylic acid |
| InChIKey | RUTJJFYMKNSTIA-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)