cas: 22358-80-1 — see every product listed under this CAS number, including other names
Thiazole-4,5-dicarboxylic acid 95% (CAS 22358-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A831488-100mg |
| cas | 22358-80-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 748.62 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6806.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A831488 |
1,3-thiazole-4,5-dicarboxylic acid (CAS 22358-80-1) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-4,5-dicarboxylic acid. InChIKey: HFHARFNUBJTTGI-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 1,3-thiazole-4,5-dicarboxylic acid |
| InChIKey | HFHARFNUBJTTGI-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)