cas: 22358-80-1 — see every product listed under this CAS number, including other names
Thiazole-4,5-dicarboxylic acid, 95%, 95% (CAS 22358-80-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BIMM-100mg |
| cas | 22358-80-1 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 1835.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,3-thiazole-4,5-dicarboxylic acid (CAS 22358-80-1) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-4,5-dicarboxylic acid. InChIKey: HFHARFNUBJTTGI-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 1,3-thiazole-4,5-dicarboxylic acid |
| InChIKey | HFHARFNUBJTTGI-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)