Thiazole-4,5-dicarboxylic acid, 95%
cas: 22358-80-1 — see every product listed under this CAS number, including other names
Thiazole-4,5-dicarboxylic acid, 95% (CAS 22358-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | HG-8440-250mg |
| cas | 22358-80-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 903.87 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 1g | 3147.87 Pln | |
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1655.31 Pln | |
| Ambeed | 5g | 6733.88 Pln | |
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1658.00 Pln | |
| Chemat | 5g | 6112.40 Pln | |
| BLDpharm | 100mg | 530.95 Pln | |
| BLDpharm | 250mg | 736.43 Pln | |
| BLDpharm | 1g | 1780.51 Pln | |
| BLDpharm | 5g | 7250.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1,3-thiazole-4,5-dicarboxylic acid (CAS 22358-80-1) is a chemical compound with the molecular formula C5H3NO4S and a molecular weight of 173.15 g/mol. IUPAC name: 1,3-thiazole-4,5-dicarboxylic acid. InChIKey: HFHARFNUBJTTGI-UHFFFAOYSA-N.
| Molecular formula | C5H3NO4S |
|---|---|
| Molecular weight | 173.15 g/mol |
| IUPAC name | 1,3-thiazole-4,5-dicarboxylic acid |
| InChIKey | HFHARFNUBJTTGI-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)