cas: 1119249-30-7 — see every product listed under this CAS number, including other names
Tos-PEG2-O-Propargyl, 98%, 98% (CAS 1119249-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 15g, 25g, 100g, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E2N-100mg |
| cas | 1119249-30-7 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 10g | 2162.00 Pln | |
| Chemat | 15g | 3117.20 Pln | |
| Chemat | 25g | 4662.80 Pln | |
| Chemat | 100g | 16312.40 Pln | |
| Chemat | 50mg | 88.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-prop-2-ynoxyethoxy)ethyl 4-methylbenzenesulfonate (CAS 1119249-30-7) is a chemical compound with the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. IUPAC name: 2-(2-prop-2-ynoxyethoxy)ethyl 4-methylbenzenesulfonate. InChIKey: XOLBARIQCXNLPS-UHFFFAOYSA-N.
| Molecular formula | C14H18O5S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2-(2-prop-2-ynoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | XOLBARIQCXNLPS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC#C |
Computed by PubChem (NCBI)