Products 845617-56-3
CAS 845617-56-3 is the registry number for 2-(Cyclopropylmethoxy)-5-(isopropylsulfonyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(cyclopropylmethoxy)-5-propan-2-ylsulfonylbenzoic acid (CAS 845617-56-3) is a chemical compound with the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. IUPAC name: 2-(cyclopropylmethoxy)-5-propan-2-ylsulfonylbenzoic acid. InChIKey: TZEAIUFFWPWUMV-UHFFFAOYSA-N.
| Molecular formula | C14H18O5S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 2-(cyclopropylmethoxy)-5-propan-2-ylsulfonylbenzoic acid |
| InChIKey | TZEAIUFFWPWUMV-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=CC(=C(C=C1)OCC2CC2)C(=O)O |
Computed by PubChem (NCBI)