Products 2920638-15-7
CAS 2920638-15-7 is the registry number for (5,7-Dioxaspiro[2.5]octan-6-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dioxaspiro[2.5]octan-6-ylmethyl 4-methylbenzenesulfonate (CAS 2920638-15-7) is a chemical compound with the molecular formula C14H18O5S and a molecular weight of 298.36 g/mol. IUPAC name: 5,7-dioxaspiro[2.5]octan-6-ylmethyl 4-methylbenzenesulfonate. InChIKey: IWDKUBMLLQFZRE-UHFFFAOYSA-N.
| Molecular formula | C14H18O5S |
|---|---|
| Molecular weight | 298.36 g/mol |
| IUPAC name | 5,7-dioxaspiro[2.5]octan-6-ylmethyl 4-methylbenzenesulfonate |
| InChIKey | IWDKUBMLLQFZRE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2OCC3(CC3)CO2 |
Computed by PubChem (NCBI)