cas: 1246999-33-6 — see every product listed under this CAS number, including other names
Tos-PEG4-NH-Boc 95% (CAS 1246999-33-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751534-100mg |
| cas | 1246999-33-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1193.62 Pln | |
| Ambeed | 25g | 5671.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751534 |
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 1246999-33-6) is a chemical compound with the molecular formula C20H33NO8S and a molecular weight of 447.5 g/mol. IUPAC name: 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: NWLAEQSWDZYPBV-UHFFFAOYSA-N.
| Molecular formula | C20H33NO8S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | NWLAEQSWDZYPBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)