cas: 581065-94-3 — see every product listed under this CAS number, including other names
Tos-PEG5-Boc 98% (CAS 581065-94-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751608-250mg |
| cas | 581065-94-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 1026.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A751608 |
Tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 581065-94-3) is a chemical compound with the molecular formula C22H36O9S and a molecular weight of 476.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GGGJGMGLGUHUMW-UHFFFAOYSA-N.
| Molecular formula | C22H36O9S |
|---|---|
| Molecular weight | 476.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GGGJGMGLGUHUMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)