CAS 419547-73-2 appears in our catalog under these names: Transketolase-IN-4/ 99.07% (existing batch purity), Transketolase–IN–4, Transketolase-IN-4 98%, Transketolase-IN-4, 99.59%, 5-Benzyl-3-(4-chlorophenyl)pyrazolo[1,5-a]pyrimidin-7(4H)-one, 98%, 98%. Offered by: TargetMol, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
5-benzyl-3-(4-chlorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 419547-73-2) is a chemical compound with the molecular formula C19H14ClN3O and a molecular weight of 335.8 g/mol. IUPAC name: 5-benzyl-3-(4-chlorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: FIFAUXGBTKHTIJ-UHFFFAOYSA-N.
| Molecular formula | C19H14ClN3O |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | 5-benzyl-3-(4-chlorophenyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | FIFAUXGBTKHTIJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=O)N3C(=N2)C(=CN3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)