Tri-o-tolyl phosphite, 95%
cas: 2622-08-4 — see every product listed under this CAS number, including other names
Tri-o-tolyl phosphite, 95% (CAS 2622-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 100g, 100mg. Offered by: Combi-blocks, Ambeed, BLDpharm, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QF-1801-1g |
| cas | 2622-08-4 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 626.25 Pln | |
| Ambeed | 25g | 2078.06 Pln | |
| Ambeed | 100g | 6789.50 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 669.79 Pln | |
| BLDpharm | 25g | 2235.90 Pln | |
| BLDpharm | 100g | 7317.45 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 643.54 Pln | |
| Fluorochem | 25g | 2137.81 Pln | |
| Fluorochem | 100g | 6818.45 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tris(2-methylphenyl) phosphite (CAS 2622-08-4) is a chemical compound with the molecular formula C21H21O3P and a molecular weight of 352.4 g/mol. IUPAC name: tris(2-methylphenyl) phosphite. InChIKey: BKHZQJRTFNFCTG-UHFFFAOYSA-N.
| Molecular formula | C21H21O3P |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | tris(2-methylphenyl) phosphite |
| InChIKey | BKHZQJRTFNFCTG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OP(OC2=CC=CC=C2C)OC3=CC=CC=C3C |
Computed by PubChem (NCBI)