Products 102660-13-9
CAS 102660-13-9 is the registry number for TPMP-I-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[dimethoxyphosphoryl(diphenyl)methyl]benzene (CAS 102660-13-9) is a chemical compound with the molecular formula C21H21O3P and a molecular weight of 352.4 g/mol. IUPAC name: [dimethoxyphosphoryl(diphenyl)methyl]benzene. InChIKey: YLBCWGMOZJDNRZ-UHFFFAOYSA-N.
| Molecular formula | C21H21O3P |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | [dimethoxyphosphoryl(diphenyl)methyl]benzene |
| InChIKey | YLBCWGMOZJDNRZ-UHFFFAOYSA-N |
| SMILES | COP(=O)(C(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)